C12H14N2O3S — CID 79518052
methyl 3-[(6-methoxy-1,3-benzothiazol-2-yl)amino]propanoate (PubChem CID 79518052) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is methyl 3-[(6-methoxy-1,3-benzothiazol-2-yl)amino]propanoate.
| Compound Name | methyl 3-[(6-methoxy-1,3-benzothiazol-2-yl)amino]propanoate |
|---|---|
| PubChem CID | 79518052 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | methyl 3-[(6-methoxy-1,3-benzothiazol-2-yl)amino]propanoate |
| SMILES | COC(=O)CCNc1nc2ccc(OC)cc2s1 |
| InChI | InChI=1S/C12H14N2O3S/c1-16-8-3-4-9-10(7-8)18-12(14-9)13-6-5-11(15)17-2/h3-4,7H,5-6H2,1-2H3,(H,13,14) |
| InChIKey | IODIRCTZWCRBQW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |