4-[(6-propoxy-1,3-benzothiazol-2-yl)amino]butanoic acid

C14H18N2O3S — CID 82193021

IUPAC4-[(6-propoxy-1,3-benzothiazol-2-yl)amino]butanoic acid
SMILESCCCOc1ccc2nc(NCCCC(=O)O)sc2c1
InChIInChI=1S/C14H18N2O3S/c1-2-8-19-10-5-6-11-12(9-10)20-14(16-11)15-7-3-4-13(17)18/h5-6,9H,2-4,7-8H2,1H3,(H,15,16)(H,17,18)
InChIKeyDKTFREOATZEZBV-UHFFFAOYSA-N
MW294.38 g/mol
LogP3.36
Rot. Bonds8

About 4-[(6-propoxy-1,3-benzothiazol-2-yl)amino]butanoic acid

4-[(6-propoxy-1,3-benzothiazol-2-yl)amino]butanoic acid (PubChem CID 82193021) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is 4-[(6-propoxy-1,3-benzothiazol-2-yl)amino]butanoic acid.

Molecular Properties

Compound Name4-[(6-propoxy-1,3-benzothiazol-2-yl)amino]butanoic acid
PubChem CID82193021
Molecular FormulaC14H18N2O3S
Molecular Weight294.38 g/mol
Exact Mass294.10
IUPAC Name4-[(6-propoxy-1,3-benzothiazol-2-yl)amino]butanoic acid
SMILESCCCOc1ccc2nc(NCCCC(=O)O)sc2c1
InChIInChI=1S/C14H18N2O3S/c1-2-8-19-10-5-6-11-12(9-10)20-14(16-11)15-7-3-4-13(17)18/h5-6,9H,2-4,7-8H2,1H3,(H,15,16)(H,17,18)
InChIKeyDKTFREOATZEZBV-UHFFFAOYSA-N
XLogP3.36
TPSA71.45 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds8
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500294.38
LogP ≤ 53.36
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-[(6-propoxy-1,3-benzothiazol-2-yl)amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(6-propoxy-1,3-benzothiazol-2-yl)amino]butanoic acid?
The IUPAC name of 4-[(6-propoxy-1,3-benzothiazol-2-yl)amino]butanoic acid (CID 82193021) is 4-[(6-propoxy-1,3-benzothiazol-2-yl)amino]butanoic acid.
What is the SMILES notation for 4-[(6-propoxy-1,3-benzothiazol-2-yl)amino]butanoic acid?
The canonical SMILES for 4-[(6-propoxy-1,3-benzothiazol-2-yl)amino]butanoic acid is CCCOc1ccc2nc(NCCCC(=O)O)sc2c1.
What is the InChIKey of 4-[(6-propoxy-1,3-benzothiazol-2-yl)amino]butanoic acid?
The InChIKey is DKTFREOATZEZBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O3S/c1-2-8-19-10-5-6-11-12(9-10)20-14(16-11)15-7-3-4-13(17)18/h5-6,9H,2-4,7-8H2,1H3,(H,15,16)(H,17,18).
What are the key properties of 4-[(6-propoxy-1,3-benzothiazol-2-yl)amino]butanoic acid?
4-[(6-propoxy-1,3-benzothiazol-2-yl)amino]butanoic acid has a molecular weight of 294.38 g/mol, XLogP of 3.36, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(6-propoxy-1,3-benzothiazol-2-yl)amino]butanoic acid is sourced from PubChem (CID 82193021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).