C11H11FN2O2S — CID 82193008
4-[(6-fluoro-1,3-benzothiazol-2-yl)amino]butanoic acid (PubChem CID 82193008) has the molecular formula C11H11FN2O2S and a molecular weight of 254.29 g/mol. Its IUPAC name is 4-[(6-fluoro-1,3-benzothiazol-2-yl)amino]butanoic acid.
| Compound Name | 4-[(6-fluoro-1,3-benzothiazol-2-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 82193008 |
| Molecular Formula | C11H11FN2O2S |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 4-[(6-fluoro-1,3-benzothiazol-2-yl)amino]butanoic acid |
| SMILES | O=C(O)CCCNc1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C11H11FN2O2S/c12-7-3-4-8-9(6-7)17-11(14-8)13-5-1-2-10(15)16/h3-4,6H,1-2,5H2,(H,13,14)(H,15,16) |
| InChIKey | SLFYTNMWSIWDMN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|