C12H14FN3OS — CID 79144613
2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-N-propylacetamide (PubChem CID 79144613) has the molecular formula C12H14FN3OS and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-N-propylacetamide.
| Compound Name | 2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-N-propylacetamide |
|---|---|
| PubChem CID | 79144613 |
| Molecular Formula | C12H14FN3OS |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-N-propylacetamide |
| SMILES | CCCNC(=O)CNc1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C12H14FN3OS/c1-2-5-14-11(17)7-15-12-16-9-4-3-8(13)6-10(9)18-12/h3-4,6H,2,5,7H2,1H3,(H,14,17)(H,15,16) |
| InChIKey | TWIMFOPFESGANK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |