C13H16ClN3OS — CID 79525880
3-[(6-chloro-1,3-benzothiazol-2-yl)amino]-N-propylpropanamide (PubChem CID 79525880) has the molecular formula C13H16ClN3OS and a molecular weight of 297.81 g/mol. Its IUPAC name is 3-[(6-chloro-1,3-benzothiazol-2-yl)amino]-N-propylpropanamide.
| Compound Name | 3-[(6-chloro-1,3-benzothiazol-2-yl)amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 79525880 |
| Molecular Formula | C13H16ClN3OS |
| Molecular Weight | 297.81 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 3-[(6-chloro-1,3-benzothiazol-2-yl)amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)CCNc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C13H16ClN3OS/c1-2-6-15-12(18)5-7-16-13-17-10-4-3-9(14)8-11(10)19-13/h3-4,8H,2,5-7H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | LIXWNRLJXLCMTB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.81 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |