C11H12ClN3OS — CID 43566527
2-[(5-chloro-1,3-benzothiazol-2-yl)amino]-N-ethylacetamide (PubChem CID 43566527) has the molecular formula C11H12ClN3OS and a molecular weight of 269.76 g/mol. Its IUPAC name is 2-[(5-chloro-1,3-benzothiazol-2-yl)amino]-N-ethylacetamide.
| Compound Name | 2-[(5-chloro-1,3-benzothiazol-2-yl)amino]-N-ethylacetamide |
|---|---|
| PubChem CID | 43566527 |
| Molecular Formula | C11H12ClN3OS |
| Molecular Weight | 269.76 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 2-[(5-chloro-1,3-benzothiazol-2-yl)amino]-N-ethylacetamide |
| SMILES | CCNC(=O)CNc1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C11H12ClN3OS/c1-2-13-10(16)6-14-11-15-8-5-7(12)3-4-9(8)17-11/h3-5H,2,6H2,1H3,(H,13,16)(H,14,15) |
| InChIKey | PQNZWFHHGZXOFO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.76 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |