C9H8ClN3OS — CID 43306475
2-[(5-chloro-1,3-benzothiazol-2-yl)amino]acetamide (PubChem CID 43306475) has the molecular formula C9H8ClN3OS and a molecular weight of 241.70 g/mol. Its IUPAC name is 2-[(5-chloro-1,3-benzothiazol-2-yl)amino]acetamide.
| Compound Name | 2-[(5-chloro-1,3-benzothiazol-2-yl)amino]acetamide |
|---|---|
| PubChem CID | 43306475 |
| Molecular Formula | C9H8ClN3OS |
| Molecular Weight | 241.70 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | 2-[(5-chloro-1,3-benzothiazol-2-yl)amino]acetamide |
| SMILES | NC(=O)CNc1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C9H8ClN3OS/c10-5-1-2-7-6(3-5)13-9(15-7)12-4-8(11)14/h1-3H,4H2,(H2,11,14)(H,12,13) |
| InChIKey | OLNUBHYQWRJGLW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.70 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |