C11H12ClN3OS — CID 79526160
4-[(6-chloro-1,3-benzothiazol-2-yl)amino]butanamide (PubChem CID 79526160) has the molecular formula C11H12ClN3OS and a molecular weight of 269.76 g/mol. Its IUPAC name is 4-[(6-chloro-1,3-benzothiazol-2-yl)amino]butanamide.
| Compound Name | 4-[(6-chloro-1,3-benzothiazol-2-yl)amino]butanamide |
|---|---|
| PubChem CID | 79526160 |
| Molecular Formula | C11H12ClN3OS |
| Molecular Weight | 269.76 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 4-[(6-chloro-1,3-benzothiazol-2-yl)amino]butanamide |
| SMILES | NC(=O)CCCNc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C11H12ClN3OS/c12-7-3-4-8-9(6-7)17-11(15-8)14-5-1-2-10(13)16/h3-4,6H,1-2,5H2,(H2,13,16)(H,14,15) |
| InChIKey | LRSYJSIVWPSAHO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.76 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|