C10H8ClNO2S — CID 79475132
methyl 2-(5-chloro-1,3-benzothiazol-2-yl)acetate (PubChem CID 79475132) has the molecular formula C10H8ClNO2S and a molecular weight of 241.70 g/mol. Its IUPAC name is methyl 2-(5-chloro-1,3-benzothiazol-2-yl)acetate.
| Compound Name | methyl 2-(5-chloro-1,3-benzothiazol-2-yl)acetate |
|---|---|
| PubChem CID | 79475132 |
| Molecular Formula | C10H8ClNO2S |
| Molecular Weight | 241.70 g/mol |
| Exact Mass | 241.00 |
| IUPAC Name | methyl 2-(5-chloro-1,3-benzothiazol-2-yl)acetate |
| SMILES | COC(=O)Cc1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C10H8ClNO2S/c1-14-10(13)5-9-12-7-4-6(11)2-3-8(7)15-9/h2-4H,5H2,1H3 |
| InChIKey | LYXIXNDZIKIPIG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.70 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |