methyl 2-(5-chloro-1,3-benzothiazol-2-yl)acetate

C10H8ClNO2S — CID 79475132

IUPACmethyl 2-(5-chloro-1,3-benzothiazol-2-yl)acetate
SMILESCOC(=O)Cc1nc2cc(Cl)ccc2s1
InChIInChI=1S/C10H8ClNO2S/c1-14-10(13)5-9-12-7-4-6(11)2-3-8(7)15-9/h2-4H,5H2,1H3
InChIKeyLYXIXNDZIKIPIG-UHFFFAOYSA-N
MW241.70 g/mol
LogP2.67
Rot. Bonds2

About methyl 2-(5-chloro-1,3-benzothiazol-2-yl)acetate

methyl 2-(5-chloro-1,3-benzothiazol-2-yl)acetate (PubChem CID 79475132) has the molecular formula C10H8ClNO2S and a molecular weight of 241.70 g/mol. Its IUPAC name is methyl 2-(5-chloro-1,3-benzothiazol-2-yl)acetate.

Molecular Properties

Compound Namemethyl 2-(5-chloro-1,3-benzothiazol-2-yl)acetate
PubChem CID79475132
Molecular FormulaC10H8ClNO2S
Molecular Weight241.70 g/mol
Exact Mass241.00
IUPAC Namemethyl 2-(5-chloro-1,3-benzothiazol-2-yl)acetate
SMILESCOC(=O)Cc1nc2cc(Cl)ccc2s1
InChIInChI=1S/C10H8ClNO2S/c1-14-10(13)5-9-12-7-4-6(11)2-3-8(7)15-9/h2-4H,5H2,1H3
InChIKeyLYXIXNDZIKIPIG-UHFFFAOYSA-N
XLogP2.67
TPSA39.19 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.70
LogP ≤ 52.67
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 2-(5-chloro-1,3-benzothiazol-2-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(5-chloro-1,3-benzothiazol-2-yl)acetate?
The IUPAC name of methyl 2-(5-chloro-1,3-benzothiazol-2-yl)acetate (CID 79475132) is methyl 2-(5-chloro-1,3-benzothiazol-2-yl)acetate.
What is the SMILES notation for methyl 2-(5-chloro-1,3-benzothiazol-2-yl)acetate?
The canonical SMILES for methyl 2-(5-chloro-1,3-benzothiazol-2-yl)acetate is COC(=O)Cc1nc2cc(Cl)ccc2s1.
What is the InChIKey of methyl 2-(5-chloro-1,3-benzothiazol-2-yl)acetate?
The InChIKey is LYXIXNDZIKIPIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClNO2S/c1-14-10(13)5-9-12-7-4-6(11)2-3-8(7)15-9/h2-4H,5H2,1H3.
What are the key properties of methyl 2-(5-chloro-1,3-benzothiazol-2-yl)acetate?
methyl 2-(5-chloro-1,3-benzothiazol-2-yl)acetate has a molecular weight of 241.70 g/mol, XLogP of 2.67, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(5-chloro-1,3-benzothiazol-2-yl)acetate is sourced from PubChem (CID 79475132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).