C11H8ClNO3S — CID 82667356
methyl 3-(5-chloro-1,3-benzothiazol-2-yl)-3-oxopropanoate (PubChem CID 82667356) has the molecular formula C11H8ClNO3S and a molecular weight of 269.71 g/mol. Its IUPAC name is methyl 3-(5-chloro-1,3-benzothiazol-2-yl)-3-oxopropanoate.
| Compound Name | methyl 3-(5-chloro-1,3-benzothiazol-2-yl)-3-oxopropanoate |
|---|---|
| PubChem CID | 82667356 |
| Molecular Formula | C11H8ClNO3S |
| Molecular Weight | 269.71 g/mol |
| Exact Mass | 268.99 |
| IUPAC Name | methyl 3-(5-chloro-1,3-benzothiazol-2-yl)-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)c1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C11H8ClNO3S/c1-16-10(15)5-8(14)11-13-7-4-6(12)2-3-9(7)17-11/h2-4H,5H2,1H3 |
| InChIKey | CPVKDDCIMQEXEK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.71 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|