C13H14ClNO2S2 — CID 47095527
tert-butyl 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]acetate (PubChem CID 47095527) has the molecular formula C13H14ClNO2S2 and a molecular weight of 315.85 g/mol. Its IUPAC name is tert-butyl 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]acetate.
| Compound Name | tert-butyl 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 47095527 |
| Molecular Formula | C13H14ClNO2S2 |
| Molecular Weight | 315.85 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | tert-butyl 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]acetate |
| SMILES | CC(C)(C)OC(=O)CSc1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C13H14ClNO2S2/c1-13(2,3)17-11(16)7-18-12-15-9-6-8(14)4-5-10(9)19-12/h4-6H,7H2,1-3H3 |
| InChIKey | IAVFYFJUVRYNFJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.85 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |