C16H17ClN2OS2 — CID 27893353
2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-N-(3-ethylpent-1-yn-3-yl)acetamide (PubChem CID 27893353) has the molecular formula C16H17ClN2OS2 and a molecular weight of 352.91 g/mol. Its IUPAC name is 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-N-(3-ethylpent-1-yn-3-yl)acetamide.
| Compound Name | 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-N-(3-ethylpent-1-yn-3-yl)acetamide |
|---|---|
| PubChem CID | 27893353 |
| Molecular Formula | C16H17ClN2OS2 |
| Molecular Weight | 352.91 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-N-(3-ethylpent-1-yn-3-yl)acetamide |
| SMILES | C#CC(CC)(CC)NC(=O)CSc1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C16H17ClN2OS2/c1-4-16(5-2,6-3)19-14(20)10-21-15-18-12-9-11(17)7-8-13(12)22-15/h1,7-9H,5-6,10H2,2-3H3,(H,19,20) |
| InChIKey | XUJHBWHAZUFCHS-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.91 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|