C18H17ClN2OS3 — CID 7604657
2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-N-[2-(4-methylphenyl)sulfanylethyl]acetamide (PubChem CID 7604657) has the molecular formula C18H17ClN2OS3 and a molecular weight of 409.00 g/mol. Its IUPAC name is 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-N-[2-(4-methylphenyl)sulfanylethyl]acetamide.
| Compound Name | 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-N-[2-(4-methylphenyl)sulfanylethyl]acetamide |
|---|---|
| PubChem CID | 7604657 |
| Molecular Formula | C18H17ClN2OS3 |
| Molecular Weight | 409.00 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-N-[2-(4-methylphenyl)sulfanylethyl]acetamide |
| SMILES | Cc1ccc(SCCNC(=O)CSc2nc3cc(Cl)ccc3s2)cc1 |
| InChI | InChI=1S/C18H17ClN2OS3/c1-12-2-5-14(6-3-12)23-9-8-20-17(22)11-24-18-21-15-10-13(19)4-7-16(15)25-18/h2-7,10H,8-9,11H2,1H3,(H,20,22) |
| InChIKey | GGYHACICMTYNDC-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.00 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|