C16H9ClN2O2S2 — CID 3995818
2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanylmethyl]isoindole-1,3-dione (PubChem CID 3995818) has the molecular formula C16H9ClN2O2S2 and a molecular weight of 360.85 g/mol. Its IUPAC name is 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanylmethyl]isoindole-1,3-dione.
| Compound Name | 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanylmethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 3995818 |
| Molecular Formula | C16H9ClN2O2S2 |
| Molecular Weight | 360.85 g/mol |
| Exact Mass | 359.98 |
| IUPAC Name | 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanylmethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CSc1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C16H9ClN2O2S2/c17-9-5-6-13-12(7-9)18-16(23-13)22-8-19-14(20)10-3-1-2-4-11(10)15(19)21/h1-7H,8H2 |
| InChIKey | QKZFVTHUGWIECW-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.85 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|