C12H11Cl2NOS2 — CID 71327130
5-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]pentanoyl chloride (PubChem CID 71327130) has the molecular formula C12H11Cl2NOS2 and a molecular weight of 320.27 g/mol. Its IUPAC name is 5-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]pentanoyl chloride.
| Compound Name | 5-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]pentanoyl chloride |
|---|---|
| PubChem CID | 71327130 |
| Molecular Formula | C12H11Cl2NOS2 |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 318.97 |
| IUPAC Name | 5-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]pentanoyl chloride |
| SMILES | O=C(Cl)CCCCSc1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C12H11Cl2NOS2/c13-8-4-5-10-9(7-8)15-12(18-10)17-6-2-1-3-11(14)16/h4-5,7H,1-3,6H2 |
| InChIKey | IIGKXILVVJCVKO-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|