C15H15ClN4OS4 — CID 4920912
N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]acetamide (PubChem CID 4920912) has the molecular formula C15H15ClN4OS4 and a molecular weight of 431.03 g/mol. Its IUPAC name is N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 4920912 |
| Molecular Formula | C15H15ClN4OS4 |
| Molecular Weight | 431.03 g/mol |
| Exact Mass | 429.98 |
| IUPAC Name | N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]acetamide |
| SMILES | CCCCSc1nnc(NC(=O)CSc2nc3cc(Cl)ccc3s2)s1 |
| InChI | InChI=1S/C15H15ClN4OS4/c1-2-3-6-22-15-20-19-13(25-15)18-12(21)8-23-14-17-10-7-9(16)4-5-11(10)24-14/h4-5,7H,2-3,6,8H2,1H3,(H,18,19,21) |
| InChIKey | QMCIUVIEJCGCAJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.03 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|