C14H16ClN3OS2 — CID 19114647
N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(4-chlorophenyl)acetamide (PubChem CID 19114647) has the molecular formula C14H16ClN3OS2 and a molecular weight of 341.89 g/mol. Its IUPAC name is N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(4-chlorophenyl)acetamide.
| Compound Name | N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 19114647 |
| Molecular Formula | C14H16ClN3OS2 |
| Molecular Weight | 341.89 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | N-(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(4-chlorophenyl)acetamide |
| SMILES | CCCCSc1nnc(NC(=O)Cc2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C14H16ClN3OS2/c1-2-3-8-20-14-18-17-13(21-14)16-12(19)9-10-4-6-11(15)7-5-10/h4-7H,2-3,8-9H2,1H3,(H,16,17,19) |
| InChIKey | GGPHYKPJSPLTOE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.89 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|