C15H18ClN3OS3 — CID 30340501
2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(4-chlorophenyl)methyl]acetamide (PubChem CID 30340501) has the molecular formula C15H18ClN3OS3 and a molecular weight of 387.98 g/mol. Its IUPAC name is 2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(4-chlorophenyl)methyl]acetamide.
| Compound Name | 2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(4-chlorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 30340501 |
| Molecular Formula | C15H18ClN3OS3 |
| Molecular Weight | 387.98 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | 2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(4-chlorophenyl)methyl]acetamide |
| SMILES | CCCCSc1nnc(SCC(=O)NCc2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C15H18ClN3OS3/c1-2-3-8-21-14-18-19-15(23-14)22-10-13(20)17-9-11-4-6-12(16)7-5-11/h4-7H,2-3,8-10H2,1H3,(H,17,20) |
| InChIKey | PJXDCHIAZMIVBA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.98 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|