C16H19N3O2S3 — CID 30360208
N-(2-acetylphenyl)-2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide (PubChem CID 30360208) has the molecular formula C16H19N3O2S3 and a molecular weight of 381.55 g/mol. Its IUPAC name is N-(2-acetylphenyl)-2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-(2-acetylphenyl)-2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 30360208 |
| Molecular Formula | C16H19N3O2S3 |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | N-(2-acetylphenyl)-2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
| SMILES | CCCCSc1nnc(SCC(=O)Nc2ccccc2C(C)=O)s1 |
| InChI | InChI=1S/C16H19N3O2S3/c1-3-4-9-22-15-18-19-16(24-15)23-10-14(21)17-13-8-6-5-7-12(13)11(2)20/h5-8H,3-4,9-10H2,1-2H3,(H,17,21) |
| InChIKey | DDBKNKRQKQBDNO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|