C22H19N3O3S3 — CID 30359719
2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(9,10-dioxoanthracen-1-yl)acetamide (PubChem CID 30359719) has the molecular formula C22H19N3O3S3 and a molecular weight of 469.61 g/mol. Its IUPAC name is 2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(9,10-dioxoanthracen-1-yl)acetamide.
| Compound Name | 2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(9,10-dioxoanthracen-1-yl)acetamide |
|---|---|
| PubChem CID | 30359719 |
| Molecular Formula | C22H19N3O3S3 |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | 2-[(5-butylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(9,10-dioxoanthracen-1-yl)acetamide |
| SMILES | CCCCSc1nnc(SCC(=O)Nc2cccc3c2C(=O)c2ccccc2C3=O)s1 |
| InChI | InChI=1S/C22H19N3O3S3/c1-2-3-11-29-21-24-25-22(31-21)30-12-17(26)23-16-10-6-9-15-18(16)20(28)14-8-5-4-7-13(14)19(15)27/h4-10H,2-3,11-12H2,1H3,(H,23,26) |
| InChIKey | FXWGSFAFMHBBNR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|