C24H16N4O3S — CID 4828384
N-(9,10-dioxoanthracen-1-yl)-2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 4828384) has the molecular formula C24H16N4O3S and a molecular weight of 440.48 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-1-yl)-2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-(9,10-dioxoanthracen-1-yl)-2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 4828384 |
| Molecular Formula | C24H16N4O3S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | N-(9,10-dioxoanthracen-1-yl)-2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nncn1-c1ccccc1)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C24H16N4O3S/c29-20(13-32-24-27-25-14-28(24)15-7-2-1-3-8-15)26-19-12-6-11-18-21(19)23(31)17-10-5-4-9-16(17)22(18)30/h1-12,14H,13H2,(H,26,29) |
| InChIKey | LMTHTTSKWWRMSI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|