C32H25N5O3S — CID 17337285
N-(9,10-dioxoanthracen-1-yl)-2-[[5-[(4-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 17337285) has the molecular formula C32H25N5O3S and a molecular weight of 559.65 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-1-yl)-2-[[5-[(4-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(9,10-dioxoanthracen-1-yl)-2-[[5-[(4-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 17337285 |
| Molecular Formula | C32H25N5O3S |
| Molecular Weight | 559.65 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | N-(9,10-dioxoanthracen-1-yl)-2-[[5-[(4-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | Cc1ccc(NCc2nnc(SCC(=O)Nc3cccc4c3C(=O)c3ccccc3C4=O)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C32H25N5O3S/c1-20-14-16-21(17-15-20)33-18-27-35-36-32(37(27)22-8-3-2-4-9-22)41-19-28(38)34-26-13-7-12-25-29(26)31(40)24-11-6-5-10-23(24)30(25)39/h2-17,33H,18-19H2,1H3,(H,34,38) |
| InChIKey | KDLVPYIGJPRAMN-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.65 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|