C26H27N5O2S — CID 995075
2-[[5-[(4-ethoxyanilino)methyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide (PubChem CID 995075) has the molecular formula C26H27N5O2S and a molecular weight of 473.60 g/mol. Its IUPAC name is 2-[[5-[(4-ethoxyanilino)methyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide.
| Compound Name | 2-[[5-[(4-ethoxyanilino)methyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 995075 |
| Molecular Formula | C26H27N5O2S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 2-[[5-[(4-ethoxyanilino)methyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide |
| SMILES | CCOc1ccc(NCc2nnc(SCC(=O)Nc3ccccc3)n2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H27N5O2S/c1-3-33-23-15-11-20(12-16-23)27-17-24-29-30-26(31(24)22-13-9-19(2)10-14-22)34-18-25(32)28-21-7-5-4-6-8-21/h4-16,27H,3,17-18H2,1-2H3,(H,28,32) |
| InChIKey | HUNSXHQDEUISMW-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|