C23H28N4O3S — CID 3711824
propan-2-yl 2-[[5-[(4-ethoxyanilino)methyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetate (PubChem CID 3711824) has the molecular formula C23H28N4O3S and a molecular weight of 440.57 g/mol. Its IUPAC name is propan-2-yl 2-[[5-[(4-ethoxyanilino)methyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetate.
| Compound Name | propan-2-yl 2-[[5-[(4-ethoxyanilino)methyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 3711824 |
| Molecular Formula | C23H28N4O3S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | propan-2-yl 2-[[5-[(4-ethoxyanilino)methyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetate |
| SMILES | CCOc1ccc(NCc2nnc(SCC(=O)OC(C)C)n2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H28N4O3S/c1-5-29-20-12-8-18(9-13-20)24-14-21-25-26-23(31-15-22(28)30-16(2)3)27(21)19-10-6-17(4)7-11-19/h6-13,16,24H,5,14-15H2,1-4H3 |
| InChIKey | NRYQVWYMTWUKSH-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|