C20H24N4OS — CID 3167102
4-ethoxy-N-[[5-ethylsulfanyl-4-(4-methylphenyl)-1,2,4-triazol-3-yl]methyl]aniline (PubChem CID 3167102) has the molecular formula C20H24N4OS and a molecular weight of 368.51 g/mol. Its IUPAC name is 4-ethoxy-N-[[5-ethylsulfanyl-4-(4-methylphenyl)-1,2,4-triazol-3-yl]methyl]aniline.
| Compound Name | 4-ethoxy-N-[[5-ethylsulfanyl-4-(4-methylphenyl)-1,2,4-triazol-3-yl]methyl]aniline |
|---|---|
| PubChem CID | 3167102 |
| Molecular Formula | C20H24N4OS |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 4-ethoxy-N-[[5-ethylsulfanyl-4-(4-methylphenyl)-1,2,4-triazol-3-yl]methyl]aniline |
| SMILES | CCOc1ccc(NCc2nnc(SCC)n2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H24N4OS/c1-4-25-18-12-8-16(9-13-18)21-14-19-22-23-20(26-5-2)24(19)17-10-6-15(3)7-11-17/h6-13,21H,4-5,14H2,1-3H3 |
| InChIKey | LHBXWTNPWLNHKU-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|