C24H23BrN4OS — CID 17386433
N-[[5-[(3-bromophenyl)methylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]methyl]-4-ethoxyaniline (PubChem CID 17386433) has the molecular formula C24H23BrN4OS and a molecular weight of 495.45 g/mol. Its IUPAC name is N-[[5-[(3-bromophenyl)methylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]methyl]-4-ethoxyaniline.
| Compound Name | N-[[5-[(3-bromophenyl)methylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]methyl]-4-ethoxyaniline |
|---|---|
| PubChem CID | 17386433 |
| Molecular Formula | C24H23BrN4OS |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | N-[[5-[(3-bromophenyl)methylsulfanyl]-4-phenyl-1,2,4-triazol-3-yl]methyl]-4-ethoxyaniline |
| SMILES | CCOc1ccc(NCc2nnc(SCc3cccc(Br)c3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H23BrN4OS/c1-2-30-22-13-11-20(12-14-22)26-16-23-27-28-24(29(23)21-9-4-3-5-10-21)31-17-18-7-6-8-19(25)15-18/h3-15,26H,2,16-17H2,1H3 |
| InChIKey | IFWWNEQRBIFCMF-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|