C30H29N5O2S — CID 3138235
2-[[5-[(4-ethoxyanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-naphthalen-1-ylpropanamide (PubChem CID 3138235) has the molecular formula C30H29N5O2S and a molecular weight of 523.66 g/mol. Its IUPAC name is 2-[[5-[(4-ethoxyanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-naphthalen-1-ylpropanamide.
| Compound Name | 2-[[5-[(4-ethoxyanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-naphthalen-1-ylpropanamide |
|---|---|
| PubChem CID | 3138235 |
| Molecular Formula | C30H29N5O2S |
| Molecular Weight | 523.66 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | 2-[[5-[(4-ethoxyanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-naphthalen-1-ylpropanamide |
| SMILES | CCOc1ccc(NCc2nnc(SC(C)C(=O)Nc3cccc4ccccc34)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H29N5O2S/c1-3-37-25-18-16-23(17-19-25)31-20-28-33-34-30(35(28)24-12-5-4-6-13-24)38-21(2)29(36)32-27-15-9-11-22-10-7-8-14-26(22)27/h4-19,21,31H,3,20H2,1-2H3,(H,32,36) |
| InChIKey | ZHERMSMUYLZXCK-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.66 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|