C29H26N6OS — CID 51389017
(2S)-N-[(Z)-benzylideneamino]-2-[[5-[(naphthalen-1-ylamino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 51389017) has the molecular formula C29H26N6OS and a molecular weight of 506.64 g/mol. Its IUPAC name is (2S)-N-[(Z)-benzylideneamino]-2-[[5-[(naphthalen-1-ylamino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | (2S)-N-[(Z)-benzylideneamino]-2-[[5-[(naphthalen-1-ylamino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 51389017 |
| Molecular Formula | C29H26N6OS |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | (2S)-N-[(Z)-benzylideneamino]-2-[[5-[(naphthalen-1-ylamino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | C[C@H](Sc1nnc(CNc2cccc3ccccc23)n1-c1ccccc1)C(=O)N/N=C\c1ccccc1 |
| InChI | InChI=1S/C29H26N6OS/c1-21(28(36)33-31-19-22-11-4-2-5-12-22)37-29-34-32-27(35(29)24-15-6-3-7-16-24)20-30-26-18-10-14-23-13-8-9-17-25(23)26/h2-19,21,30H,20H2,1H3,(H,33,36)/b31-19-/t21-/m0/s1 |
| InChIKey | KTPBXTMTHJXVMQ-FKLQAHIASA-N |
| XLogP | 5.66 |
| TPSA | 84.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|