C25H22BrClN6OS — CID 6018942
N-[(Z)-(4-bromophenyl)methylideneamino]-2-[[5-[(4-chloroanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 6018942) has the molecular formula C25H22BrClN6OS and a molecular weight of 569.92 g/mol. Its IUPAC name is N-[(Z)-(4-bromophenyl)methylideneamino]-2-[[5-[(4-chloroanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | N-[(Z)-(4-bromophenyl)methylideneamino]-2-[[5-[(4-chloroanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 6018942 |
| Molecular Formula | C25H22BrClN6OS |
| Molecular Weight | 569.92 g/mol |
| Exact Mass | 568.04 |
| IUPAC Name | N-[(Z)-(4-bromophenyl)methylideneamino]-2-[[5-[(4-chloroanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | CC(Sc1nnc(CNc2ccc(Cl)cc2)n1-c1ccccc1)C(=O)N/N=C\c1ccc(Br)cc1 |
| InChI | InChI=1S/C25H22BrClN6OS/c1-17(24(34)31-29-15-18-7-9-19(26)10-8-18)35-25-32-30-23(33(25)22-5-3-2-4-6-22)16-28-21-13-11-20(27)12-14-21/h2-15,17,28H,16H2,1H3,(H,31,34)/b29-15- |
| InChIKey | RQEGTLLNRQJDEV-FDVSRXAVSA-N |
| XLogP | 5.93 |
| TPSA | 84.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.92 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|