C23H20BrN7O3S2 — CID 71833427
2-[[5-[(4-bromoanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(5-nitrothiophen-2-yl)methylideneamino]propanamide (PubChem CID 71833427) has the molecular formula C23H20BrN7O3S2 and a molecular weight of 586.50 g/mol. Its IUPAC name is 2-[[5-[(4-bromoanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(5-nitrothiophen-2-yl)methylideneamino]propanamide.
| Compound Name | 2-[[5-[(4-bromoanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(5-nitrothiophen-2-yl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 71833427 |
| Molecular Formula | C23H20BrN7O3S2 |
| Molecular Weight | 586.50 g/mol |
| Exact Mass | 585.03 |
| IUPAC Name | 2-[[5-[(4-bromoanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(5-nitrothiophen-2-yl)methylideneamino]propanamide |
| SMILES | CC(Sc1nnc(CNc2ccc(Br)cc2)n1-c1ccccc1)C(=O)NN=Cc1ccc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C23H20BrN7O3S2/c1-15(22(32)28-26-13-19-11-12-21(36-19)31(33)34)35-23-29-27-20(30(23)18-5-3-2-4-6-18)14-25-17-9-7-16(24)8-10-17/h2-13,15,25H,14H2,1H3,(H,28,32) |
| InChIKey | WSSDRPHPZQWYDX-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 127.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.50 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|