C22H23N7O3S — CID 51389398
(2R)-2-[[5-(anilinomethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(4-nitrophenyl)methylideneamino]propanamide (PubChem CID 51389398) has the molecular formula C22H23N7O3S and a molecular weight of 465.54 g/mol. Its IUPAC name is (2R)-2-[[5-(anilinomethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(4-nitrophenyl)methylideneamino]propanamide.
| Compound Name | (2R)-2-[[5-(anilinomethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(4-nitrophenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 51389398 |
| Molecular Formula | C22H23N7O3S |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | (2R)-2-[[5-(anilinomethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(4-nitrophenyl)methylideneamino]propanamide |
| SMILES | C=CCn1c(CNc2ccccc2)nnc1S[C@H](C)C(=O)N/N=C\c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H23N7O3S/c1-3-13-28-20(15-23-18-7-5-4-6-8-18)25-27-22(28)33-16(2)21(30)26-24-14-17-9-11-19(12-10-17)29(31)32/h3-12,14,16,23H,1,13,15H2,2H3,(H,26,30)/b24-14-/t16-/m1/s1 |
| InChIKey | CSQBAKWKADTEFG-DNPFKWNUSA-N |
| XLogP | 3.62 |
| TPSA | 127.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|