C23H25IN6O3S — CID 136705959
(2R)-N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-2-[[5-[(4-iodoanilino)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 136705959) has the molecular formula C23H25IN6O3S and a molecular weight of 592.46 g/mol. Its IUPAC name is (2R)-N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-2-[[5-[(4-iodoanilino)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | (2R)-N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-2-[[5-[(4-iodoanilino)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 136705959 |
| Molecular Formula | C23H25IN6O3S |
| Molecular Weight | 592.46 g/mol |
| Exact Mass | 592.08 |
| IUPAC Name | (2R)-N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-2-[[5-[(4-iodoanilino)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | C=CCn1c(CNc2ccc(I)cc2)nnc1S[C@H](C)C(=O)N/N=C\c1cccc(OC)c1O |
| InChI | InChI=1S/C23H25IN6O3S/c1-4-12-30-20(14-25-18-10-8-17(24)9-11-18)27-29-23(30)34-15(2)22(32)28-26-13-16-6-5-7-19(33-3)21(16)31/h4-11,13,15,25,31H,1,12,14H2,2-3H3,(H,28,32)/b26-13-/t15-/m1/s1 |
| InChIKey | UNXNWJPLIFUSTE-LCJWJQHCSA-N |
| XLogP | 4.03 |
| TPSA | 113.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|