C22H23IN6O2S — CID 999804
2-[[5-[(4-iodoanilino)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2-methoxyphenyl)methylideneamino]acetamide (PubChem CID 999804) has the molecular formula C22H23IN6O2S and a molecular weight of 562.44 g/mol. Its IUPAC name is 2-[[5-[(4-iodoanilino)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[5-[(4-iodoanilino)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 999804 |
| Molecular Formula | C22H23IN6O2S |
| Molecular Weight | 562.44 g/mol |
| Exact Mass | 562.06 |
| IUPAC Name | 2-[[5-[(4-iodoanilino)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2-methoxyphenyl)methylideneamino]acetamide |
| SMILES | C=CCn1c(CNc2ccc(I)cc2)nnc1SCC(=O)NN=Cc1ccccc1OC |
| InChI | InChI=1S/C22H23IN6O2S/c1-3-12-29-20(14-24-18-10-8-17(23)9-11-18)26-28-22(29)32-15-21(30)27-25-13-16-6-4-5-7-19(16)31-2/h3-11,13,24H,1,12,14-15H2,2H3,(H,27,30) |
| InChIKey | PVOGJJVEPREMHP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|