C21H22ClN5O2S — CID 1222251
2-[[5-[(4-chloroanilino)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyphenyl)acetamide (PubChem CID 1222251) has the molecular formula C21H22ClN5O2S and a molecular weight of 443.96 g/mol. Its IUPAC name is 2-[[5-[(4-chloroanilino)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[[5-[(4-chloroanilino)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 1222251 |
| Molecular Formula | C21H22ClN5O2S |
| Molecular Weight | 443.96 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 2-[[5-[(4-chloroanilino)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyphenyl)acetamide |
| SMILES | C=CCn1c(CNc2ccc(Cl)cc2)nnc1SCC(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C21H22ClN5O2S/c1-3-12-27-19(13-23-16-10-8-15(22)9-11-16)25-26-21(27)30-14-20(28)24-17-6-4-5-7-18(17)29-2/h3-11,23H,1,12-14H2,2H3,(H,24,28) |
| InChIKey | ZWVRESGHNIXGJO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.96 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|