C23H22ClN5O4S — CID 126355812
methyl 2-[[2-[[5-[[(4-chlorobenzoyl)amino]methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate (PubChem CID 126355812) has the molecular formula C23H22ClN5O4S and a molecular weight of 499.98 g/mol. Its IUPAC name is methyl 2-[[2-[[5-[[(4-chlorobenzoyl)amino]methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[[5-[[(4-chlorobenzoyl)amino]methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126355812 |
| Molecular Formula | C23H22ClN5O4S |
| Molecular Weight | 499.98 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | methyl 2-[[2-[[5-[[(4-chlorobenzoyl)amino]methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate |
| SMILES | C=CCn1c(CNC(=O)c2ccc(Cl)cc2)nnc1SCC(=O)Nc1ccccc1C(=O)OC |
| InChI | InChI=1S/C23H22ClN5O4S/c1-3-12-29-19(13-25-21(31)15-8-10-16(24)11-9-15)27-28-23(29)34-14-20(30)26-18-7-5-4-6-17(18)22(32)33-2/h3-11H,1,12-14H2,2H3,(H,25,31)(H,26,30) |
| InChIKey | SIJFFNAOYZXTMR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.98 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|