C22H22ClN5O3S — CID 126369593
4-chloro-N-[[5-[2-(3-methoxyanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]benzamide (PubChem CID 126369593) has the molecular formula C22H22ClN5O3S and a molecular weight of 471.97 g/mol. Its IUPAC name is 4-chloro-N-[[5-[2-(3-methoxyanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]benzamide.
| Compound Name | 4-chloro-N-[[5-[2-(3-methoxyanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 126369593 |
| Molecular Formula | C22H22ClN5O3S |
| Molecular Weight | 471.97 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | 4-chloro-N-[[5-[2-(3-methoxyanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]benzamide |
| SMILES | C=CCn1c(CNC(=O)c2ccc(Cl)cc2)nnc1SCC(=O)Nc1cccc(OC)c1 |
| InChI | InChI=1S/C22H22ClN5O3S/c1-3-11-28-19(13-24-21(30)15-7-9-16(23)10-8-15)26-27-22(28)32-14-20(29)25-17-5-4-6-18(12-17)31-2/h3-10,12H,1,11,13-14H2,2H3,(H,24,30)(H,25,29) |
| InChIKey | MYBCCGFFOPXYMD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.97 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|