C22H21Cl2N5O3S — CID 126348874
N-[[5-[2-(2,3-dichloroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]-4-methoxybenzamide (PubChem CID 126348874) has the molecular formula C22H21Cl2N5O3S and a molecular weight of 506.42 g/mol. Its IUPAC name is N-[[5-[2-(2,3-dichloroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]-4-methoxybenzamide.
| Compound Name | N-[[5-[2-(2,3-dichloroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 126348874 |
| Molecular Formula | C22H21Cl2N5O3S |
| Molecular Weight | 506.42 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | N-[[5-[2-(2,3-dichloroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]methyl]-4-methoxybenzamide |
| SMILES | C=CCn1c(CNC(=O)c2ccc(OC)cc2)nnc1SCC(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C22H21Cl2N5O3S/c1-3-11-29-18(12-25-21(31)14-7-9-15(32-2)10-8-14)27-28-22(29)33-13-19(30)26-17-6-4-5-16(23)20(17)24/h3-10H,1,11-13H2,2H3,(H,25,31)(H,26,30) |
| InChIKey | HLUNVFZEQVNAIU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|