C23H23Cl2N5O3S — CID 21379490
2,4-dichloro-N-[1-[5-[2-(3-methoxyanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide (PubChem CID 21379490) has the molecular formula C23H23Cl2N5O3S and a molecular weight of 520.44 g/mol. Its IUPAC name is 2,4-dichloro-N-[1-[5-[2-(3-methoxyanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[1-[5-[2-(3-methoxyanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 21379490 |
| Molecular Formula | C23H23Cl2N5O3S |
| Molecular Weight | 520.44 g/mol |
| Exact Mass | 519.09 |
| IUPAC Name | 2,4-dichloro-N-[1-[5-[2-(3-methoxyanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cccc(OC)c2)nnc1C(C)NC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H23Cl2N5O3S/c1-4-10-30-21(14(2)26-22(32)18-9-8-15(24)11-19(18)25)28-29-23(30)34-13-20(31)27-16-6-5-7-17(12-16)33-3/h4-9,11-12,14H,1,10,13H2,2-3H3,(H,26,32)(H,27,31) |
| InChIKey | WILROHNPTHFYBC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.44 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|