C24H25Cl2N5O2S — CID 126348929
N-[(1R)-1-[5-(2-anilino-2-oxoethyl)sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-methylpropyl]-2,4-dichlorobenzamide (PubChem CID 126348929) has the molecular formula C24H25Cl2N5O2S and a molecular weight of 518.47 g/mol. Its IUPAC name is N-[(1R)-1-[5-(2-anilino-2-oxoethyl)sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-methylpropyl]-2,4-dichlorobenzamide.
| Compound Name | N-[(1R)-1-[5-(2-anilino-2-oxoethyl)sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-methylpropyl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 126348929 |
| Molecular Formula | C24H25Cl2N5O2S |
| Molecular Weight | 518.47 g/mol |
| Exact Mass | 517.11 |
| IUPAC Name | N-[(1R)-1-[5-(2-anilino-2-oxoethyl)sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-methylpropyl]-2,4-dichlorobenzamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccccc2)nnc1[C@H](NC(=O)c1ccc(Cl)cc1Cl)C(C)C |
| InChI | InChI=1S/C24H25Cl2N5O2S/c1-4-12-31-22(21(15(2)3)28-23(33)18-11-10-16(25)13-19(18)26)29-30-24(31)34-14-20(32)27-17-8-6-5-7-9-17/h4-11,13,15,21H,1,12,14H2,2-3H3,(H,27,32)(H,28,33)/t21-/m1/s1 |
| InChIKey | HQWAKOGCVJFQAE-OAQYLSRUSA-N |
| XLogP | 5.63 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.47 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|