C30H30ClN7O2S — CID 124559116
2-chloro-N-[(1R)-2-methyl-1-[5-[2-oxo-2-(4-phenyldiazenylanilino)ethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]propyl]benzamide (PubChem CID 124559116) has the molecular formula C30H30ClN7O2S and a molecular weight of 588.14 g/mol. Its IUPAC name is 2-chloro-N-[(1R)-2-methyl-1-[5-[2-oxo-2-(4-phenyldiazenylanilino)ethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]propyl]benzamide.
| Compound Name | 2-chloro-N-[(1R)-2-methyl-1-[5-[2-oxo-2-(4-phenyldiazenylanilino)ethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]propyl]benzamide |
|---|---|
| PubChem CID | 124559116 |
| Molecular Formula | C30H30ClN7O2S |
| Molecular Weight | 588.14 g/mol |
| Exact Mass | 587.19 |
| IUPAC Name | 2-chloro-N-[(1R)-2-methyl-1-[5-[2-oxo-2-(4-phenyldiazenylanilino)ethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]propyl]benzamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(/N=N/c3ccccc3)cc2)nnc1[C@H](NC(=O)c1ccccc1Cl)C(C)C |
| InChI | InChI=1S/C30H30ClN7O2S/c1-4-18-38-28(27(20(2)3)33-29(40)24-12-8-9-13-25(24)31)36-37-30(38)41-19-26(39)32-21-14-16-23(17-15-21)35-34-22-10-6-5-7-11-22/h4-17,20,27H,1,18-19H2,2-3H3,(H,32,39)(H,33,40)/b35-34+/t27-/m1/s1 |
| InChIKey | QNYOTOPSVNTRAX-DPOXMIBISA-N |
| XLogP | 7.39 |
| TPSA | 113.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.14 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|