C28H26ClN7O2S — CID 21379380
3-chloro-N-[1-[5-[2-oxo-2-(4-phenyldiazenylanilino)ethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide (PubChem CID 21379380) has the molecular formula C28H26ClN7O2S and a molecular weight of 560.08 g/mol. Its IUPAC name is 3-chloro-N-[1-[5-[2-oxo-2-(4-phenyldiazenylanilino)ethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide.
| Compound Name | 3-chloro-N-[1-[5-[2-oxo-2-(4-phenyldiazenylanilino)ethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 21379380 |
| Molecular Formula | C28H26ClN7O2S |
| Molecular Weight | 560.08 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | 3-chloro-N-[1-[5-[2-oxo-2-(4-phenyldiazenylanilino)ethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]benzamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(/N=N/c3ccccc3)cc2)nnc1C(C)NC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C28H26ClN7O2S/c1-3-16-36-26(19(2)30-27(38)20-8-7-9-21(29)17-20)34-35-28(36)39-18-25(37)31-22-12-14-24(15-13-22)33-32-23-10-5-4-6-11-23/h3-15,17,19H,1,16,18H2,2H3,(H,30,38)(H,31,37)/b33-32+ |
| InChIKey | FRGCCCGEWYICIC-ULIFNZDWSA-N |
| XLogP | 6.75 |
| TPSA | 113.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.08 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|