C25H28ClN5O2S — CID 21379165
N-[1-[5-[2-(3-chloroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-3-methylbutyl]benzamide (PubChem CID 21379165) has the molecular formula C25H28ClN5O2S and a molecular weight of 498.05 g/mol. Its IUPAC name is N-[1-[5-[2-(3-chloroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-3-methylbutyl]benzamide.
| Compound Name | N-[1-[5-[2-(3-chloroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-3-methylbutyl]benzamide |
|---|---|
| PubChem CID | 21379165 |
| Molecular Formula | C25H28ClN5O2S |
| Molecular Weight | 498.05 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | N-[1-[5-[2-(3-chloroanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-3-methylbutyl]benzamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cccc(Cl)c2)nnc1C(CC(C)C)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H28ClN5O2S/c1-4-13-31-23(21(14-17(2)3)28-24(33)18-9-6-5-7-10-18)29-30-25(31)34-16-22(32)27-20-12-8-11-19(26)15-20/h4-12,15,17,21H,1,13-14,16H2,2-3H3,(H,27,32)(H,28,33) |
| InChIKey | ROLSDUCFXDNSNE-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.05 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|