C27H33N5O2S — CID 21379175
N-[1-[5-[2-(4-ethylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-3-methylbutyl]benzamide (PubChem CID 21379175) has the molecular formula C27H33N5O2S and a molecular weight of 491.66 g/mol. Its IUPAC name is N-[1-[5-[2-(4-ethylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-3-methylbutyl]benzamide.
| Compound Name | N-[1-[5-[2-(4-ethylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-3-methylbutyl]benzamide |
|---|---|
| PubChem CID | 21379175 |
| Molecular Formula | C27H33N5O2S |
| Molecular Weight | 491.66 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | N-[1-[5-[2-(4-ethylanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-3-methylbutyl]benzamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(CC)cc2)nnc1C(CC(C)C)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H33N5O2S/c1-5-16-32-25(23(17-19(3)4)29-26(34)21-10-8-7-9-11-21)30-31-27(32)35-18-24(33)28-22-14-12-20(6-2)13-15-22/h5,7-15,19,23H,1,6,16-18H2,2-4H3,(H,28,33)(H,29,34) |
| InChIKey | YBCACXIXOJHSPJ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.66 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|