C26H31N5O3S — CID 21379173
N-[1-[5-[2-(4-methoxyanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-3-methylbutyl]benzamide (PubChem CID 21379173) has the molecular formula C26H31N5O3S and a molecular weight of 493.63 g/mol. Its IUPAC name is N-[1-[5-[2-(4-methoxyanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-3-methylbutyl]benzamide.
| Compound Name | N-[1-[5-[2-(4-methoxyanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-3-methylbutyl]benzamide |
|---|---|
| PubChem CID | 21379173 |
| Molecular Formula | C26H31N5O3S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | N-[1-[5-[2-(4-methoxyanilino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-3-methylbutyl]benzamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(OC)cc2)nnc1C(CC(C)C)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H31N5O3S/c1-5-15-31-24(22(16-18(2)3)28-25(33)19-9-7-6-8-10-19)29-30-26(31)35-17-23(32)27-20-11-13-21(34-4)14-12-20/h5-14,18,22H,1,15-17H2,2-4H3,(H,27,32)(H,28,33) |
| InChIKey | GXKGTIFTKGLVER-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|