C22H23N5O3S — CID 2224247
N-[(1S)-1-[5-(2-anilino-2-oxoethyl)sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-hydroxyethyl]benzamide (PubChem CID 2224247) has the molecular formula C22H23N5O3S and a molecular weight of 437.53 g/mol. Its IUPAC name is N-[(1S)-1-[5-(2-anilino-2-oxoethyl)sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-hydroxyethyl]benzamide.
| Compound Name | N-[(1S)-1-[5-(2-anilino-2-oxoethyl)sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-hydroxyethyl]benzamide |
|---|---|
| PubChem CID | 2224247 |
| Molecular Formula | C22H23N5O3S |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | N-[(1S)-1-[5-(2-anilino-2-oxoethyl)sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-hydroxyethyl]benzamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccccc2)nnc1[C@@H](CO)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H23N5O3S/c1-2-13-27-20(18(14-28)24-21(30)16-9-5-3-6-10-16)25-26-22(27)31-15-19(29)23-17-11-7-4-8-12-17/h2-12,18,28H,1,13-15H2,(H,23,29)(H,24,30)/t18-/m1/s1 |
| InChIKey | NBAMKNGSEWOAQM-GOSISDBHSA-N |
| XLogP | 2.66 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|