C26H31N5O2S — CID 21379226
N-[1-[5-[2-(benzylamino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-3-methylbutyl]benzamide (PubChem CID 21379226) has the molecular formula C26H31N5O2S and a molecular weight of 477.63 g/mol. Its IUPAC name is N-[1-[5-[2-(benzylamino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-3-methylbutyl]benzamide.
| Compound Name | N-[1-[5-[2-(benzylamino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-3-methylbutyl]benzamide |
|---|---|
| PubChem CID | 21379226 |
| Molecular Formula | C26H31N5O2S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | N-[1-[5-[2-(benzylamino)-2-oxoethyl]sulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl]-3-methylbutyl]benzamide |
| SMILES | C=CCn1c(SCC(=O)NCc2ccccc2)nnc1C(CC(C)C)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H31N5O2S/c1-4-15-31-24(22(16-19(2)3)28-25(33)21-13-9-6-10-14-21)29-30-26(31)34-18-23(32)27-17-20-11-7-5-8-12-20/h4-14,19,22H,1,15-18H2,2-3H3,(H,27,32)(H,28,33) |
| InChIKey | WDYFLWLVWFLKKQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|