C17H21ClN4OS — CID 19717260
N-[(4-chlorophenyl)methyl]-2-[(5-propan-2-yl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 19717260) has the molecular formula C17H21ClN4OS and a molecular weight of 364.90 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-[(5-propan-2-yl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-[(5-propan-2-yl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 19717260 |
| Molecular Formula | C17H21ClN4OS |
| Molecular Weight | 364.90 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-[(5-propan-2-yl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)NCc2ccc(Cl)cc2)nnc1C(C)C |
| InChI | InChI=1S/C17H21ClN4OS/c1-4-9-22-16(12(2)3)20-21-17(22)24-11-15(23)19-10-13-5-7-14(18)8-6-13/h4-8,12H,1,9-11H2,2-3H3,(H,19,23) |
| InChIKey | GHPPYJPGPHKDHL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.90 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|