C14H16ClN5OS — CID 134001517
2-[(5-amino-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(4-chlorophenyl)methyl]acetamide (PubChem CID 134001517) has the molecular formula C14H16ClN5OS and a molecular weight of 337.84 g/mol. Its IUPAC name is 2-[(5-amino-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(4-chlorophenyl)methyl]acetamide.
| Compound Name | 2-[(5-amino-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(4-chlorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 134001517 |
| Molecular Formula | C14H16ClN5OS |
| Molecular Weight | 337.84 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 2-[(5-amino-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(4-chlorophenyl)methyl]acetamide |
| SMILES | C=CCn1c(N)nnc1SCC(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H16ClN5OS/c1-2-7-20-13(16)18-19-14(20)22-9-12(21)17-8-10-3-5-11(15)6-4-10/h2-6H,1,7-9H2,(H2,16,18)(H,17,21) |
| InChIKey | JOQKKSXHIRHNKL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.84 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|