C26H32N4O2S — CID 19639684
N-benzyl-2-[[5-[1-(4-tert-butylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19639684) has the molecular formula C26H32N4O2S and a molecular weight of 464.64 g/mol. Its IUPAC name is N-benzyl-2-[[5-[1-(4-tert-butylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-benzyl-2-[[5-[1-(4-tert-butylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19639684 |
| Molecular Formula | C26H32N4O2S |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | N-benzyl-2-[[5-[1-(4-tert-butylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)NCc2ccccc2)nnc1C(C)Oc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H32N4O2S/c1-6-16-30-24(19(2)32-22-14-12-21(13-15-22)26(3,4)5)28-29-25(30)33-18-23(31)27-17-20-10-8-7-9-11-20/h6-15,19H,1,16-18H2,2-5H3,(H,27,31) |
| InChIKey | VSPPPXBEONMMAG-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|