C25H29BrN4O2S — CID 19639634
N-(4-bromophenyl)-2-[[5-[1-(4-tert-butylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19639634) has the molecular formula C25H29BrN4O2S and a molecular weight of 529.50 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[[5-[1-(4-tert-butylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(4-bromophenyl)-2-[[5-[1-(4-tert-butylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19639634 |
| Molecular Formula | C25H29BrN4O2S |
| Molecular Weight | 529.50 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | N-(4-bromophenyl)-2-[[5-[1-(4-tert-butylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(Br)cc2)nnc1C(C)Oc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H29BrN4O2S/c1-6-15-30-23(17(2)32-21-13-7-18(8-14-21)25(3,4)5)28-29-24(30)33-16-22(31)27-20-11-9-19(26)10-12-20/h6-14,17H,1,15-16H2,2-5H3,(H,27,31) |
| InChIKey | XIVAVODUFLRLSW-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.50 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|